C28H32Cl2N4O — CID 67596623
2-amino-N-[[1-[bis(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-5-(dimethylamino)benzamide (PubChem CID 67596623) has the molecular formula C28H32Cl2N4O and a molecular weight of 511.50 g/mol. Its IUPAC name is 2-amino-N-[[1-[bis(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-5-(dimethylamino)benzamide.
| Compound Name | 2-amino-N-[[1-[bis(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-5-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 67596623 |
| Molecular Formula | C28H32Cl2N4O |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2-amino-N-[[1-[bis(4-chlorophenyl)methyl]piperidin-4-yl]methyl]-5-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(N)c(C(=O)NCC2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C28H32Cl2N4O/c1-33(2)24-11-12-26(31)25(17-24)28(35)32-18-19-13-15-34(16-14-19)27(20-3-7-22(29)8-4-20)21-5-9-23(30)10-6-21/h3-12,17,19,27H,13-16,18,31H2,1-2H3,(H,32,35) |
| InChIKey | LAOMTXQNWFPHHM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|