C23H28BrClN2O — CID 66993402
2-bromo-N-[[4-[(4-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]methyl]benzamide (PubChem CID 66993402) has the molecular formula C23H28BrClN2O and a molecular weight of 463.85 g/mol. Its IUPAC name is 2-bromo-N-[[4-[(4-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]methyl]benzamide.
| Compound Name | 2-bromo-N-[[4-[(4-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 66993402 |
| Molecular Formula | C23H28BrClN2O |
| Molecular Weight | 463.85 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-bromo-N-[[4-[(4-chlorophenyl)-(dimethylamino)methyl]cyclohexyl]methyl]benzamide |
| SMILES | CN(C)C(c1ccc(Cl)cc1)C1CCC(CNC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C23H28BrClN2O/c1-27(2)22(18-11-13-19(25)14-12-18)17-9-7-16(8-10-17)15-26-23(28)20-5-3-4-6-21(20)24/h3-6,11-14,16-17,22H,7-10,15H2,1-2H3,(H,26,28) |
| InChIKey | GIRYIHXZACRKOH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.85 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |