C38H51N5O2 — CID 67594657
N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[carbamoyl(heptyl)amino]-5-pyrrolidin-1-ylbenzamide (PubChem CID 67594657) has the molecular formula C38H51N5O2 and a molecular weight of 609.86 g/mol. Its IUPAC name is N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[carbamoyl(heptyl)amino]-5-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[carbamoyl(heptyl)amino]-5-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 67594657 |
| Molecular Formula | C38H51N5O2 |
| Molecular Weight | 609.86 g/mol |
| Exact Mass | 609.40 |
| IUPAC Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[carbamoyl(heptyl)amino]-5-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCCCCN(C(N)=O)c1ccc(N2CCCC2)cc1C(=O)NCC1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C38H51N5O2/c1-2-3-4-5-12-25-43(38(39)45)35-20-19-33(41-23-13-14-24-41)28-34(35)37(44)40-29-30-21-26-42(27-22-30)36(31-15-8-6-9-16-31)32-17-10-7-11-18-32/h6-11,15-20,28,30,36H,2-5,12-14,21-27,29H2,1H3,(H2,39,45)(H,40,44) |
| InChIKey | IVEOPNKEQHKMEB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.86 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|