C30H30N4O — CID 56997406
N-[(1-benzhydrylpiperidin-4-yl)methyl]-2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide (PubChem CID 56997406) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[(1-benzhydrylpiperidin-4-yl)methyl]-2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide.
| Compound Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide |
|---|---|
| PubChem CID | 56997406 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),3,5,7,9-pentaene-6-carboxamide |
| SMILES | O=C(NCC1CCN(C(c2ccccc2)c2ccccc2)CC1)C1=CC2=CNC3=CC=CC(=C1)N23 |
| InChI | InChI=1S/C30H30N4O/c35-30(25-18-26-12-7-13-28-31-21-27(19-25)34(26)28)32-20-22-14-16-33(17-15-22)29(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-13,18-19,21-22,29,31H,14-17,20H2,(H,32,35) |
| InChIKey | QCVBDYDVEMSYMX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |