C18H24INO3 — CID 18293041
[2-(2-iodoanilino)-2-oxoethyl] 4-cyclohexylbutanoate (PubChem CID 18293041) has the molecular formula C18H24INO3 and a molecular weight of 429.30 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 18293041 |
| Molecular Formula | C18H24INO3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl] 4-cyclohexylbutanoate |
| SMILES | O=C(COC(=O)CCCC1CCCCC1)Nc1ccccc1I |
| InChI | InChI=1S/C18H24INO3/c19-15-10-4-5-11-16(15)20-17(21)13-23-18(22)12-6-9-14-7-2-1-3-8-14/h4-5,10-11,14H,1-3,6-9,12-13H2,(H,20,21) |
| InChIKey | VRZVTUNCIJZHHK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|