C17H19NO3S — CID 154859038
4-methoxy-N-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide (PubChem CID 154859038) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-methoxy-N-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154859038 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-methoxy-N-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCc3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C17H19NO3S/c1-12-3-9-16-13(11-12)4-10-17(16)18-22(19,20)15-7-5-14(21-2)6-8-15/h3,5-9,11,17-18H,4,10H2,1-2H3 |
| InChIKey | FWXUPXYPPMYJJE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |