C19H27NO8 — CID 13132300
tert-butyl 2-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)amino]acetate;oxalic acid (PubChem CID 13132300) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is tert-butyl 2-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)amino]acetate;oxalic acid.
| Compound Name | tert-butyl 2-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)amino]acetate;oxalic acid |
|---|---|
| PubChem CID | 13132300 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl 2-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)amino]acetate;oxalic acid |
| SMILES | COc1cc2c(cc1OC)C(NCC(=O)OC(C)(C)C)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H25NO4.C2H2O4/c1-17(2,3)22-16(19)10-18-13-7-6-11-8-14(20-4)15(21-5)9-12(11)13;3-1(4)2(5)6/h8-9,13,18H,6-7,10H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | TXBLQIWXNRZERU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|