C34H42N2O4Si — CID 18433528
tert-butyl N-[1-[6-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 18433528) has the molecular formula C34H42N2O4Si and a molecular weight of 570.81 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 18433528 |
| Molecular Formula | C34H42N2O4Si |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | tert-butyl N-[1-[6-[tert-butyl(diphenyl)silyl]oxy-2,3-dihydro-1H-inden-1-yl]-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C2CCc3ccc(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)cc32)C1=O |
| InChI | InChI=1S/C34H42N2O4Si/c1-33(2,3)39-32(38)35-29-21-22-36(31(29)37)30-20-18-24-17-19-25(23-28(24)30)40-41(34(4,5)6,26-13-9-7-10-14-26)27-15-11-8-12-16-27/h7-17,19,23,29-30H,18,20-22H2,1-6H3,(H,35,38) |
| InChIKey | MELPSAPZWINCLX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|