C19H21NO — CID 145489426
8-benzyl-2-methoxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-imine (PubChem CID 145489426) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 8-benzyl-2-methoxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-imine.
| Compound Name | 8-benzyl-2-methoxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-imine |
|---|---|
| PubChem CID | 145489426 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 8-benzyl-2-methoxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-imine |
| SMILES | [H]/N=C1\Cc2ccc(OC)cc2CC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H21NO/c1-21-19-8-7-16-12-18(20)11-15(10-17(16)13-19)9-14-5-3-2-4-6-14/h2-8,13,15,20H,9-12H2,1H3/b20-18- |
| InChIKey | WWVRCLHZHLFMOY-ZZEZOPTASA-N |
| XLogP | 4.06 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|