C15H23N — CID 134425720
3,6,7-triethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 134425720) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3,6,7-triethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3,6,7-triethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 134425720 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3,6,7-triethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCc1cc2c(cc1CC)CC(CC)NC2 |
| InChI | InChI=1S/C15H23N/c1-4-11-7-13-9-15(6-3)16-10-14(13)8-12(11)5-2/h7-8,15-16H,4-6,9-10H2,1-3H3 |
| InChIKey | FKAVOFTTYOJGIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |