C19H23NO — CID 10802790
(E)-8-(6-methoxy-3,4-dihydronaphthalen-1-yl)oct-5-enenitrile (PubChem CID 10802790) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (E)-8-(6-methoxy-3,4-dihydronaphthalen-1-yl)oct-5-enenitrile.
| Compound Name | (E)-8-(6-methoxy-3,4-dihydronaphthalen-1-yl)oct-5-enenitrile |
|---|---|
| PubChem CID | 10802790 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (E)-8-(6-methoxy-3,4-dihydronaphthalen-1-yl)oct-5-enenitrile |
| SMILES | COc1ccc2c(c1)CCC=C2CC/C=C/CCCC#N |
| InChI | InChI=1S/C19H23NO/c1-21-18-12-13-19-16(10-8-11-17(19)15-18)9-6-4-2-3-5-7-14-20/h2,4,10,12-13,15H,3,5-9,11H2,1H3/b4-2+ |
| InChIKey | YSZGFYRMDDQQFQ-DUXPYHPUSA-N |
| XLogP | 5.06 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|