C15H17NO3 — CID 118564183
(E)-5-(6-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl)pent-2-enal (PubChem CID 118564183) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (E)-5-(6-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl)pent-2-enal.
| Compound Name | (E)-5-(6-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl)pent-2-enal |
|---|---|
| PubChem CID | 118564183 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (E)-5-(6-methoxy-1-oxo-3,4-dihydroisoquinolin-2-yl)pent-2-enal |
| SMILES | COc1ccc2c(c1)CCN(CC/C=C/C=O)C2=O |
| InChI | InChI=1S/C15H17NO3/c1-19-13-5-6-14-12(11-13)7-9-16(15(14)18)8-3-2-4-10-17/h2,4-6,10-11H,3,7-9H2,1H3/b4-2+ |
| InChIKey | GETZOVBTJZLTHH-DUXPYHPUSA-N |
| XLogP | 1.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|