C20H23NO2 — CID 118184867
2-(4-tert-butylphenyl)-6-methoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 118184867) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6-methoxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(4-tert-butylphenyl)-6-methoxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 118184867 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6-methoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1ccc2c(c1)CCN(c1ccc(C(C)(C)C)cc1)C2=O |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)15-5-7-16(8-6-15)21-12-11-14-13-17(23-4)9-10-18(14)19(21)22/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | UBINJGUISNXJBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |