C15H20O3 — CID 91068807
3-[2-(ethoxymethoxy)ethylidene]-6-methoxy-1,2-dihydroindene (PubChem CID 91068807) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-[2-(ethoxymethoxy)ethylidene]-6-methoxy-1,2-dihydroindene.
| Compound Name | 3-[2-(ethoxymethoxy)ethylidene]-6-methoxy-1,2-dihydroindene |
|---|---|
| PubChem CID | 91068807 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-[2-(ethoxymethoxy)ethylidene]-6-methoxy-1,2-dihydroindene |
| SMILES | CCOCOCC=C1CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C15H20O3/c1-3-17-11-18-9-8-12-4-5-13-10-14(16-2)6-7-15(12)13/h6-8,10H,3-5,9,11H2,1-2H3 |
| InChIKey | GXEKDJPZDGANAG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|