C12H14O3 — CID 104986117
5-(ethoxymethoxy)-2,3-dihydroinden-1-one (PubChem CID 104986117) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-(ethoxymethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(ethoxymethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104986117 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-(ethoxymethoxy)-2,3-dihydroinden-1-one |
| SMILES | CCOCOc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C12H14O3/c1-2-14-8-15-10-4-5-11-9(7-10)3-6-12(11)13/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | KGATUKPAZSGFPK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|