C14H16O2 — CID 104986130
5-pent-4-enoxy-2,3-dihydroinden-1-one (PubChem CID 104986130) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-pent-4-enoxy-2,3-dihydroinden-1-one.
| Compound Name | 5-pent-4-enoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 104986130 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 5-pent-4-enoxy-2,3-dihydroinden-1-one |
| SMILES | C=CCCCOc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C14H16O2/c1-2-3-4-9-16-12-6-7-13-11(10-12)5-8-14(13)15/h2,6-7,10H,1,3-5,8-9H2 |
| InChIKey | FBMIIPDZQVIADA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|