C15H14O2S — CID 102670879
5-(2-thiophen-3-ylethoxy)-2,3-dihydroinden-1-one (PubChem CID 102670879) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 5-(2-thiophen-3-ylethoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-thiophen-3-ylethoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 102670879 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-(2-thiophen-3-ylethoxy)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OCCc3ccsc3)ccc21 |
| InChI | InChI=1S/C15H14O2S/c16-15-4-1-12-9-13(2-3-14(12)15)17-7-5-11-6-8-18-10-11/h2-3,6,8-10H,1,4-5,7H2 |
| InChIKey | XIZUQQSCPURQFP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |