About 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate
2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate (PubChem CID 171068203) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate |
| PubChem CID | 171068203 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCOc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C15H18O5/c1-11(16)19-8-6-18-7-9-20-13-3-4-14-12(10-13)2-5-15(14)17/h3-4,10H,2,5-9H2,1H3 |
| InChIKey | KOJVIWDXJKAUIU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate?
The IUPAC name of 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate (CID 171068203) is 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate.
What is the SMILES notation for 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate?
The canonical SMILES for 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate is CC(=O)OCCOCCOc1ccc2c(c1)CCC2=O.
What is the InChIKey of 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate?
The InChIKey is KOJVIWDXJKAUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O5/c1-11(16)19-8-6-18-7-9-20-13-3-4-14-12(10-13)2-5-15(14)17/h3-4,10H,2,5-9H2,1H3.
What are the key properties of 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate?
2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate has a molecular weight of 278.30 g/mol, XLogP of 1.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]ethoxy]ethyl acetate is sourced from PubChem (CID 171068203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).