C11H10FNO3 — CID 143296533
N-fluoro-2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]acetamide (PubChem CID 143296533) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is N-fluoro-2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]acetamide.
| Compound Name | N-fluoro-2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]acetamide |
|---|---|
| PubChem CID | 143296533 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-fluoro-2-[(1-oxo-2,3-dihydroinden-5-yl)oxy]acetamide |
| SMILES | O=C(COc1ccc2c(c1)CCC2=O)NF |
| InChI | InChI=1S/C11H10FNO3/c12-13-11(15)6-16-8-2-3-9-7(5-8)1-4-10(9)14/h2-3,5H,1,4,6H2,(H,13,15) |
| InChIKey | KQCMLAGVOJUYFH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|