C15H18O3 — CID 62033294
6-(4-oxopentoxy)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 62033294) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-(4-oxopentoxy)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-(4-oxopentoxy)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 62033294 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 6-(4-oxopentoxy)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(=O)CCCOc1ccc2c(c1)CCCC2=O |
| InChI | InChI=1S/C15H18O3/c1-11(16)4-3-9-18-13-7-8-14-12(10-13)5-2-6-15(14)17/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | PJSHQSADJPEBPD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|