C14H13F3O2 — CID 59150258
(1E)-1-[8-(trifluoromethyl)-3,4-dihydro-1H-2-benzoxepin-5-ylidene]propan-2-one (PubChem CID 59150258) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is (1E)-1-[8-(trifluoromethyl)-3,4-dihydro-1H-2-benzoxepin-5-ylidene]propan-2-one.
| Compound Name | (1E)-1-[8-(trifluoromethyl)-3,4-dihydro-1H-2-benzoxepin-5-ylidene]propan-2-one |
|---|---|
| PubChem CID | 59150258 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (1E)-1-[8-(trifluoromethyl)-3,4-dihydro-1H-2-benzoxepin-5-ylidene]propan-2-one |
| SMILES | CC(=O)/C=C1\CCOCc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H13F3O2/c1-9(18)6-10-4-5-19-8-11-7-12(14(15,16)17)2-3-13(10)11/h2-3,6-7H,4-5,8H2,1H3/b10-6+ |
| InChIKey | FESUTDFWXWSCJU-UXBLZVDNSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|