C23H23NO3 — CID 72598603
4-[[3-methyl-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enoyl]amino]benzoic acid (PubChem CID 72598603) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-[[3-methyl-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[3-methyl-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 72598603 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-[[3-methyl-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enoyl]amino]benzoic acid |
| SMILES | CC(=CC(=O)Nc1ccc(C(=O)O)cc1)C=C1CCCCc2ccccc21 |
| InChI | InChI=1S/C23H23NO3/c1-16(14-19-8-3-2-6-17-7-4-5-9-21(17)19)15-22(25)24-20-12-10-18(11-13-20)23(26)27/h4-5,7,9-15H,2-3,6,8H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | SDOWTRDTZZPVGA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|