(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid

C13H14O2 — CID 135039237

IUPAC(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid
SMILESC/C(C(=O)O)=C1/CCCc2ccccc21
InChIInChI=1S/C13H14O2/c1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7H,4,6,8H2,1H3,(H,14,15)/b11-9+
InChIKeyULVLOYZABWGVJG-PKNBQFBNSA-N
MW202.25 g/mol
LogP2.88
Rot. Bonds1

About (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid

(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid (PubChem CID 135039237) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid.

Molecular Properties

Compound Name(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid
PubChem CID135039237
Molecular FormulaC13H14O2
Molecular Weight202.25 g/mol
Exact Mass202.10
IUPAC Name(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid
SMILESC/C(C(=O)O)=C1/CCCc2ccccc21
InChIInChI=1S/C13H14O2/c1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7H,4,6,8H2,1H3,(H,14,15)/b11-9+
InChIKeyULVLOYZABWGVJG-PKNBQFBNSA-N
XLogP2.88
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid?
The IUPAC name of (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid (CID 135039237) is (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid.
What is the SMILES notation for (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid?
The canonical SMILES for (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid is C/C(C(=O)O)=C1/CCCc2ccccc21.
What is the InChIKey of (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid?
The InChIKey is ULVLOYZABWGVJG-PKNBQFBNSA-N. The full InChI is InChI=1S/C13H14O2/c1-9(13(14)15)11-8-4-6-10-5-2-3-7-12(10)11/h2-3,5,7H,4,6,8H2,1H3,(H,14,15)/b11-9+.
What are the key properties of (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid?
(2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid has a molecular weight of 202.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(3,4-dihydro-2H-naphthalen-1-ylidene)propanoic acid is sourced from PubChem (CID 135039237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).