C12H12O3 — CID 131557201
(2E)-2-(2,3-dihydrochromen-4-ylidene)propanoic acid (PubChem CID 131557201) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2E)-2-(2,3-dihydrochromen-4-ylidene)propanoic acid.
| Compound Name | (2E)-2-(2,3-dihydrochromen-4-ylidene)propanoic acid |
|---|---|
| PubChem CID | 131557201 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (2E)-2-(2,3-dihydrochromen-4-ylidene)propanoic acid |
| SMILES | C/C(C(=O)O)=C1/CCOc2ccccc21 |
| InChI | InChI=1S/C12H12O3/c1-8(12(13)14)9-6-7-15-11-5-3-2-4-10(9)11/h2-5H,6-7H2,1H3,(H,13,14)/b9-8+ |
| InChIKey | VSQRHZLXIVQHGD-CMDGGOBGSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|