About 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile
5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile (PubChem CID 139221321) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile |
| PubChem CID | 139221321 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile |
| SMILES | N#CC1=C(N)c2ccccc2CCC1 |
| InChI | InChI=1S/C12H12N2/c13-8-10-6-3-5-9-4-1-2-7-11(9)12(10)14/h1-2,4,7H,3,5-6,14H2 |
| InChIKey | GSOQXPMCFFJCKM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile?
The IUPAC name of 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile (CID 139221321) is 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile.
What is the SMILES notation for 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile?
The canonical SMILES for 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile is N#CC1=C(N)c2ccccc2CCC1.
What is the InChIKey of 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile?
The InChIKey is GSOQXPMCFFJCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c13-8-10-6-3-5-9-4-1-2-7-11(9)12(10)14/h1-2,4,7H,3,5-6,14H2.
What are the key properties of 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile?
5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile has a molecular weight of 184.24 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile is sourced from PubChem (CID 139221321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).