C12H13IN2S — CID 135881787
5-thia-3-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-4-amine iodide (PubChem CID 135881787) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 5-thia-3-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-4-amine iodide.
| Compound Name | 5-thia-3-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-4-amine iodide |
|---|---|
| PubChem CID | 135881787 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 5-thia-3-azoniatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-4-amine iodide |
| SMILES | Nc1[nH+]c2c(s1)CCCc1ccccc1-2.[I-] |
| InChI | InChI=1S/C12H12N2S.HI/c13-12-14-11-9-6-2-1-4-8(9)5-3-7-10(11)15-12;/h1-2,4,6H,3,5,7H2,(H2,13,14);1H |
| InChIKey | HOPWHRUCHHPDMQ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|