C12H11IN2O2S — CID 135881782
(2-amino-4H-indeno[1,2-d][1,3]thiazol-1-ium-5-yl) acetate iodide (PubChem CID 135881782) has the molecular formula C12H11IN2O2S and a molecular weight of 374.20 g/mol. Its IUPAC name is (2-amino-4H-indeno[1,2-d][1,3]thiazol-1-ium-5-yl) acetate iodide.
| Compound Name | (2-amino-4H-indeno[1,2-d][1,3]thiazol-1-ium-5-yl) acetate iodide |
|---|---|
| PubChem CID | 135881782 |
| Molecular Formula | C12H11IN2O2S |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | (2-amino-4H-indeno[1,2-d][1,3]thiazol-1-ium-5-yl) acetate iodide |
| SMILES | CC(=O)Oc1cccc2c1Cc1sc(N)[nH+]c1-2.[I-] |
| InChI | InChI=1S/C12H10N2O2S.HI/c1-6(15)16-9-4-2-3-7-8(9)5-10-11(7)14-12(13)17-10;/h2-4H,5H2,1H3,(H2,13,14);1H |
| InChIKey | OYFWSJUVLXBPKC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|