C18H18IN3S — CID 135906489
6-[4-(dimethylamino)phenyl]-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide (PubChem CID 135906489) has the molecular formula C18H18IN3S and a molecular weight of 435.33 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide.
| Compound Name | 6-[4-(dimethylamino)phenyl]-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide |
|---|---|
| PubChem CID | 135906489 |
| Molecular Formula | C18H18IN3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-4H-indeno[1,2-d][1,3]thiazol-1-ium-2-amine iodide |
| SMILES | CN(C)c1ccc(-c2ccc3c(c2)Cc2sc(N)[nH+]c2-3)cc1.[I-] |
| InChI | InChI=1S/C18H17N3S.HI/c1-21(2)14-6-3-11(4-7-14)12-5-8-15-13(9-12)10-16-17(15)20-18(19)22-16;/h3-9H,10H2,1-2H3,(H2,19,20);1H |
| InChIKey | NGQAGYKZLKYGKQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 43.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|