C19H22N6 — CID 54222591
4,6-bis[4-(dimethylamino)phenyl]-1,3,5-triazin-2-amine (PubChem CID 54222591) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 4,6-bis[4-(dimethylamino)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[4-(dimethylamino)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54222591 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4,6-bis[4-(dimethylamino)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1ccc(-c2nc(N)nc(-c3ccc(N(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C19H22N6/c1-24(2)15-9-5-13(6-10-15)17-21-18(23-19(20)22-17)14-7-11-16(12-8-14)25(3)4/h5-12H,1-4H3,(H2,20,21,22,23) |
| InChIKey | QDQJMFUPSCYXFI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |