C37H32N6 — CID 147427849
4-[4-(4-carbazol-9-ylphenyl)-6-[4-(dimethylamino)phenyl]-1,3,5-triazin-2-yl]-N,N-dimethylaniline (PubChem CID 147427849) has the molecular formula C37H32N6 and a molecular weight of 560.71 g/mol. Its IUPAC name is 4-[4-(4-carbazol-9-ylphenyl)-6-[4-(dimethylamino)phenyl]-1,3,5-triazin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(4-carbazol-9-ylphenyl)-6-[4-(dimethylamino)phenyl]-1,3,5-triazin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 147427849 |
| Molecular Formula | C37H32N6 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 4-[4-(4-carbazol-9-ylphenyl)-6-[4-(dimethylamino)phenyl]-1,3,5-triazin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc(-c3ccc(N(C)C)cc3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C37H32N6/c1-41(2)28-19-13-25(14-20-28)35-38-36(26-15-21-29(22-16-26)42(3)4)40-37(39-35)27-17-23-30(24-18-27)43-33-11-7-5-9-31(33)32-10-6-8-12-34(32)43/h5-24H,1-4H3 |
| InChIKey | DTTBUGNKMQSPJK-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |