C15H11F8N3 — CID 15526289
N,N-dimethyl-4-[4-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)pyrimidin-2-yl]aniline (PubChem CID 15526289) has the molecular formula C15H11F8N3 and a molecular weight of 385.26 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)pyrimidin-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[4-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 15526289 |
| Molecular Formula | C15H11F8N3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N,N-dimethyl-4-[4-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)pyrimidin-2-yl]aniline |
| SMILES | CN(C)c1ccc(-c2nc(C(F)(F)F)cc(C(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H11F8N3/c1-26(2)9-5-3-8(4-6-9)12-24-10(13(16,17)15(21,22)23)7-11(25-12)14(18,19)20/h3-7H,1-2H3 |
| InChIKey | WBFIJOBLRGJXMI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|