C11H10S — CID 143818370
4-ethenylidene-2,3-dihydrothiochromene (PubChem CID 143818370) has the molecular formula C11H10S and a molecular weight of 174.27 g/mol. Its IUPAC name is 4-ethenylidene-2,3-dihydrothiochromene.
| Compound Name | 4-ethenylidene-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 143818370 |
| Molecular Formula | C11H10S |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-ethenylidene-2,3-dihydrothiochromene |
| SMILES | C=C=C1CCSc2ccccc21 |
| InChI | InChI=1S/C11H10S/c1-2-9-7-8-12-11-6-4-3-5-10(9)11/h3-6H,1,7-8H2 |
| InChIKey | KJBZLDXYOBSXAF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |