C21H28S — CID 143450248
8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene;4-methylidene-2,3-dihydrothiochromene (PubChem CID 143450248) has the molecular formula C21H28S and a molecular weight of 312.52 g/mol. Its IUPAC name is 8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene;4-methylidene-2,3-dihydrothiochromene.
| Compound Name | 8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene;4-methylidene-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 143450248 |
| Molecular Formula | C21H28S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 8-methylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene;4-methylidene-2,3-dihydrothiochromene |
| SMILES | C=C1CCCC2CCCCC12.C=C1CCSc2ccccc21 |
| InChI | InChI=1S/C11H18.C10H10S/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-8-6-7-11-10-5-3-2-4-9(8)10/h10-11H,1-8H2;2-5H,1,6-7H2 |
| InChIKey | LJTQCLGOUOIMRP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|