C14H12OS2 — CID 134090714
10-oxa-8,12-dithiatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene (PubChem CID 134090714) has the molecular formula C14H12OS2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 10-oxa-8,12-dithiatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene.
| Compound Name | 10-oxa-8,12-dithiatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 134090714 |
| Molecular Formula | C14H12OS2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 10-oxa-8,12-dithiatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene |
| SMILES | c1ccc2c(c1)SCOCSc1ccccc1-2 |
| InChI | InChI=1S/C14H12OS2/c1-3-7-13-11(5-1)12-6-2-4-8-14(12)17-10-15-9-16-13/h1-8H,9-10H2 |
| InChIKey | MJVTVGXCQJQTSL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |