C28H22O2 — CID 174264154
anthracene;1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 174264154) has the molecular formula C28H22O2 and a molecular weight of 390.48 g/mol. Its IUPAC name is anthracene;1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | anthracene;1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 174264154 |
| Molecular Formula | C28H22O2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | anthracene;1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)c2ccccc21.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H12O2.C14H10/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-2,5-6H,3-4,7-8H2;1-10H |
| InChIKey | IQNGWLCDCYCWSK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|