C29H22N2O4 — CID 163979453
4-amino-1-(4-amino-9,10-dioxoanthracen-1-yl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]naphthalene-5,11-dione (PubChem CID 163979453) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-amino-1-(4-amino-9,10-dioxoanthracen-1-yl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]naphthalene-5,11-dione.
| Compound Name | 4-amino-1-(4-amino-9,10-dioxoanthracen-1-yl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]naphthalene-5,11-dione |
|---|---|
| PubChem CID | 163979453 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 4-amino-1-(4-amino-9,10-dioxoanthracen-1-yl)-7,8,9,10-tetrahydro-6H-cyclohepta[b]naphthalene-5,11-dione |
| SMILES | Nc1ccc(-c2ccc(N)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)C1=C(CCCCC1)C2=O |
| InChI | InChI=1S/C29H22N2O4/c30-20-12-10-14(22-24(20)28(34)18-7-3-1-2-6-16(18)26(22)32)15-11-13-21(31)25-23(15)27(33)17-8-4-5-9-19(17)29(25)35/h4-5,8-13H,1-3,6-7,30-31H2 |
| InChIKey | SXBXPXKAJZBSFI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|