C16H14O2 — CID 178049561
8-methylidene-6,7,9,10-tetrahydrocyclohepta[b]naphthalene-5,11-dione (PubChem CID 178049561) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 8-methylidene-6,7,9,10-tetrahydrocyclohepta[b]naphthalene-5,11-dione.
| Compound Name | 8-methylidene-6,7,9,10-tetrahydrocyclohepta[b]naphthalene-5,11-dione |
|---|---|
| PubChem CID | 178049561 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 8-methylidene-6,7,9,10-tetrahydrocyclohepta[b]naphthalene-5,11-dione |
| SMILES | C=C1CCC2=C(CC1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H14O2/c1-10-6-8-13-14(9-7-10)16(18)12-5-3-2-4-11(12)15(13)17/h2-5H,1,6-9H2 |
| InChIKey | ZPLIJMPVCAUGMH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|