C14H10O3 — CID 102335356
2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione (PubChem CID 102335356) has the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione.
| Compound Name | 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione |
|---|---|
| PubChem CID | 102335356 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione |
| SMILES | O=C1C2=C(OCC=CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H10O3/c15-12-9-5-1-2-6-10(9)13(16)14-11(12)7-3-4-8-17-14/h1-6H,7-8H2 |
| InChIKey | OIYVIQOZRNGDJM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|