About 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione
2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione (PubChem CID 102335356) has the molecular formula C14H10O3
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione.
Molecular Properties
| Compound Name | 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione |
| PubChem CID | 102335356 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione |
| SMILES | O=C1C2=C(OCC=CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H10O3/c15-12-9-5-1-2-6-10(9)13(16)14-11(12)7-3-4-8-17-14/h1-6H,7-8H2 |
| InChIKey | OIYVIQOZRNGDJM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione?
The IUPAC name of 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione (CID 102335356) is 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione.
What is the SMILES notation for 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione?
The canonical SMILES for 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione is O=C1C2=C(OCC=CC2)C(=O)c2ccccc21.
What is the InChIKey of 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione?
The InChIKey is OIYVIQOZRNGDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O3/c15-12-9-5-1-2-6-10(9)13(16)14-11(12)7-3-4-8-17-14/h1-6H,7-8H2.
What are the key properties of 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione?
2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione has a molecular weight of 226.23 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydrobenzo[h][1]benzoxepine-6,11-dione is sourced from PubChem (CID 102335356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).