About (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate
(1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate (PubChem CID 89160679) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate.
Analyze (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate?
The IUPAC name of (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate (CID 89160679) is (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate.
What is the SMILES notation for (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate?
The canonical SMILES for (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate is C=C1CC(OC(C)=O)CC(C)(C)N1OC(C)=O.
What is the InChIKey of (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate?
The InChIKey is LMCZEOYGWAYJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c1-8-6-11(16-9(2)14)7-12(4,5)13(8)17-10(3)15/h11H,1,6-7H2,2-5H3.
What are the key properties of (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate?
(1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate has a molecular weight of 241.29 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyloxy-2,2-dimethyl-6-methylidenepiperidin-4-yl) acetate is sourced from PubChem (CID 89160679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).