C15H24O3 — CID 10753330
[(3aR,4S,6R,8aS)-4-hydroxy-2,2-dimethyl-8-methylidene-1,3,3a,4,5,6,7,8a-octahydroazulen-6-yl] acetate (PubChem CID 10753330) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is [(3aR,4S,6R,8aS)-4-hydroxy-2,2-dimethyl-8-methylidene-1,3,3a,4,5,6,7,8a-octahydroazulen-6-yl] acetate.
| Compound Name | [(3aR,4S,6R,8aS)-4-hydroxy-2,2-dimethyl-8-methylidene-1,3,3a,4,5,6,7,8a-octahydroazulen-6-yl] acetate |
|---|---|
| PubChem CID | 10753330 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [(3aR,4S,6R,8aS)-4-hydroxy-2,2-dimethyl-8-methylidene-1,3,3a,4,5,6,7,8a-octahydroazulen-6-yl] acetate |
| SMILES | C=C1C[C@@H](OC(C)=O)C[C@H](O)[C@@H]2CC(C)(C)C[C@H]12 |
| InChI | InChI=1S/C15H24O3/c1-9-5-11(18-10(2)16)6-14(17)13-8-15(3,4)7-12(9)13/h11-14,17H,1,5-8H2,2-4H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | BDQYQAWRYZYLRF-SYQHCUMBSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|