C24H34O5 — CID 540983
(17-acetyloxy-4,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate (PubChem CID 540983) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (17-acetyloxy-4,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate.
| Compound Name | (17-acetyloxy-4,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate |
|---|---|
| PubChem CID | 540983 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (17-acetyloxy-4,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-10-yl)methyl acetate |
| SMILES | CC(=O)OCC12CCC(=O)C(C)=C1CCC1C2CCC2(C)C(OC(C)=O)CCC12 |
| InChI | InChI=1S/C24H34O5/c1-14-18-6-5-17-19-7-8-22(29-16(3)26)23(19,4)11-9-20(17)24(18,12-10-21(14)27)13-28-15(2)25/h17,19-20,22H,5-13H2,1-4H3 |
| InChIKey | XRBDALSRILISNL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |