C22H34O7 — CID 137078284
[(1S,3S,4R,6S,8S,10S,12R,13R,14R,16R)-3,4,6,12,14-pentahydroxy-5,5,14-trimethyl-9-methylidene-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] acetate (PubChem CID 137078284) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(1S,3S,4R,6S,8S,10S,12R,13R,14R,16R)-3,4,6,12,14-pentahydroxy-5,5,14-trimethyl-9-methylidene-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] acetate.
| Compound Name | [(1S,3S,4R,6S,8S,10S,12R,13R,14R,16R)-3,4,6,12,14-pentahydroxy-5,5,14-trimethyl-9-methylidene-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] acetate |
|---|---|
| PubChem CID | 137078284 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(1S,3S,4R,6S,8S,10S,12R,13R,14R,16R)-3,4,6,12,14-pentahydroxy-5,5,14-trimethyl-9-methylidene-16-tetracyclo[11.2.1.01,10.04,8]hexadecanyl] acetate |
| SMILES | C=C1[C@@H]2C[C@@H](O)[C@@H]3[C@@H](OC(C)=O)[C@@]2(C[C@H](O)[C@@]2(O)[C@H]1C[C@H](O)C2(C)C)C[C@@]3(C)O |
| InChI | InChI=1S/C22H34O7/c1-10-12-6-14(24)17-18(29-11(2)23)21(12,9-20(17,5)27)8-16(26)22(28)13(10)7-15(25)19(22,3)4/h12-18,24-28H,1,6-9H2,2-5H3/t12-,13-,14+,15-,16-,17+,18+,20+,21-,22-/m0/s1 |
| InChIKey | TTWLHQVDFPFJTP-BSBFRPLDSA-N |
| XLogP | 0.52 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|