C25H34O7 — CID 537201
(17-acetyl-11-acetyloxy-9-hydroxy-10-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl)methyl acetate (PubChem CID 537201) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is (17-acetyl-11-acetyloxy-9-hydroxy-10-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl)methyl acetate.
| Compound Name | (17-acetyl-11-acetyloxy-9-hydroxy-10-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl)methyl acetate |
|---|---|
| PubChem CID | 537201 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (17-acetyl-11-acetyloxy-9-hydroxy-10-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-13-yl)methyl acetate |
| SMILES | CC(=O)OCC12CC(OC(C)=O)C3(O)C(CCC4=CC(=O)CCC43C)C1CCC2C(C)=O |
| InChI | InChI=1S/C25H34O7/c1-14(26)19-7-8-20-21-6-5-17-11-18(29)9-10-23(17,4)25(21,30)22(32-16(3)28)12-24(19,20)13-31-15(2)27/h11,19-22,30H,5-10,12-13H2,1-4H3 |
| InChIKey | URAYSOIWPMWRBF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |