C23H31ClO6 — CID 21139584
[(8S,9R,10S,11S,13S,14S,17R)-9-chloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 21139584) has the molecular formula C23H31ClO6 and a molecular weight of 438.95 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17R)-9-chloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17R)-9-chloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 21139584 |
| Molecular Formula | C23H31ClO6 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17R)-9-chloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)[C@@H](CC[C@]2(O)C(=O)CO)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@]12Cl |
| InChI | InChI=1S/C23H31ClO6/c1-13(26)30-19-11-21(3)16(7-9-22(21,29)18(28)12-25)17-5-4-14-10-15(27)6-8-20(14,2)23(17,19)24/h10,16-17,19,25,29H,4-9,11-12H2,1-3H3/t16-,17-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | GEYOPFNPLGMXMR-CQETUWSJSA-N |
| XLogP | 2.71 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|