C23H31BrO7 — CID 57025529
[(8S,9R,10R,11S,13S,14S,17R)-9-bromo-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] acetate (PubChem CID 57025529) has the molecular formula C23H31BrO7 and a molecular weight of 499.40 g/mol. Its IUPAC name is [(8S,9R,10R,11S,13S,14S,17R)-9-bromo-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] acetate.
| Compound Name | [(8S,9R,10R,11S,13S,14S,17R)-9-bromo-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 57025529 |
| Molecular Formula | C23H31BrO7 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [(8S,9R,10R,11S,13S,14S,17R)-9-bromo-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@](O)(C(=O)CO)[C@@]4(C)C[C@H](O)[C@]3(Br)[C@]21C |
| InChI | InChI=1S/C23H31BrO7/c1-12(26)31-19-9-14(27)8-13-4-5-16-15-6-7-22(30,18(29)11-25)20(15,2)10-17(28)23(16,24)21(13,19)3/h8,15-17,19,25,28,30H,4-7,9-11H2,1-3H3/t15-,16-,17-,19?,20-,21+,22-,23-/m0/s1 |
| InChIKey | VMMREPLTYQCUDX-GOXSEMRWSA-N |
| XLogP | 1.84 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|