C22H32O8S — CID 87387478
[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-1-yl] methanesulfonate (PubChem CID 87387478) has the molecular formula C22H32O8S and a molecular weight of 456.56 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-1-yl] methanesulfonate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 87387478 |
| Molecular Formula | C22H32O8S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-1-yl] methanesulfonate |
| SMILES | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC(OS(C)(=O)=O)[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C22H32O8S/c1-20-10-16(25)19-14(15(20)6-7-22(20,27)17(26)11-23)5-4-12-8-13(24)9-18(21(12,19)2)30-31(3,28)29/h8,14-16,18-19,23,25,27H,4-7,9-11H2,1-3H3/t14-,15-,16-,18?,19+,20-,21+,22-/m0/s1 |
| InChIKey | JBAIWWIBJXRMRA-NPJLUZMCSA-N |
| XLogP | 0.74 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|