C27H34O5 — CID 175286684
(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1-phenyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 175286684) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1-phenyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1-phenyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 175286684 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1-phenyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](O)[C@H]3[C@@H](CCC4=CC(=O)CC(c5ccccc5)[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C27H34O5/c1-25-14-22(30)24-19(20(25)10-11-27(25,32)23(31)15-28)9-8-17-12-18(29)13-21(26(17,24)2)16-6-4-3-5-7-16/h3-7,12,19-22,24,28,30,32H,8-11,13-15H2,1-2H3/t19-,20-,21?,22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | KKLGENPUDMNGDE-GJHKMLTMSA-N |
| XLogP | 3.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |