C26H38O7S — CID 175111642
[(8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9-sulfanyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] pentanoate (PubChem CID 175111642) has the molecular formula C26H38O7S and a molecular weight of 494.65 g/mol. Its IUPAC name is [(8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9-sulfanyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] pentanoate.
| Compound Name | [(8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9-sulfanyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] pentanoate |
|---|---|
| PubChem CID | 175111642 |
| Molecular Formula | C26H38O7S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-9-sulfanyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-1-yl] pentanoate |
| SMILES | CCCCC(=O)OC1CC(=O)C=C2CC[C@H]3[C@@H]4CC[C@](O)(C(=O)CO)[C@@]4(C)C[C@H](O)[C@]3(S)[C@]21C |
| InChI | InChI=1S/C26H38O7S/c1-4-5-6-22(31)33-21-12-16(28)11-15-7-8-18-17-9-10-25(32,20(30)14-27)23(17,2)13-19(29)26(18,34)24(15,21)3/h11,17-19,21,27,29,32,34H,4-10,12-14H2,1-3H3/t17-,18-,19-,21?,23-,24+,25-,26-/m0/s1 |
| InChIKey | CKJJXSOVEXLZOJ-KDUFZFCDSA-N |
| XLogP | 2.55 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|