C18H28O6 — CID 135021783
[(1R,4S,5R,6R,7S,8S,9S,11R,13R)-6,9-dihydroxy-7-methoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate (PubChem CID 135021783) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(1R,4S,5R,6R,7S,8S,9S,11R,13R)-6,9-dihydroxy-7-methoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate.
| Compound Name | [(1R,4S,5R,6R,7S,8S,9S,11R,13R)-6,9-dihydroxy-7-methoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate |
|---|---|
| PubChem CID | 135021783 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1R,4S,5R,6R,7S,8S,9S,11R,13R)-6,9-dihydroxy-7-methoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate |
| SMILES | CO[C@@H]1[C@H](O)[C@@H]2[C@H]3O[C@]4([C@H](OC(C)=O)C[C@](C)(O)[C@H]13)[C@H]2CC4(C)C |
| InChI | InChI=1S/C18H28O6/c1-8(19)23-10-7-17(4,21)12-14-11(13(20)15(12)22-5)9-6-16(2,3)18(9,10)24-14/h9-15,20-21H,6-7H2,1-5H3/t9-,10+,11+,12-,13+,14+,15-,17-,18-/m0/s1 |
| InChIKey | HVSFSKJYOSGVCJ-MLZJOIJKSA-N |
| XLogP | 0.88 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |