C19H28O6 — CID 10871879
[(1R,2S,3R,7S,8S,9R,11R)-11-acetyloxy-9-hydroxy-2,6,6,9-tetramethyl-5-oxo-3-tricyclo[5.4.0.02,8]undecanyl] acetate (PubChem CID 10871879) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(1R,2S,3R,7S,8S,9R,11R)-11-acetyloxy-9-hydroxy-2,6,6,9-tetramethyl-5-oxo-3-tricyclo[5.4.0.02,8]undecanyl] acetate.
| Compound Name | [(1R,2S,3R,7S,8S,9R,11R)-11-acetyloxy-9-hydroxy-2,6,6,9-tetramethyl-5-oxo-3-tricyclo[5.4.0.02,8]undecanyl] acetate |
|---|---|
| PubChem CID | 10871879 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [(1R,2S,3R,7S,8S,9R,11R)-11-acetyloxy-9-hydroxy-2,6,6,9-tetramethyl-5-oxo-3-tricyclo[5.4.0.02,8]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@](C)(O)[C@H]2[C@@H]3[C@@H]1[C@]2(C)[C@H](OC(C)=O)CC(=O)C3(C)C |
| InChI | InChI=1S/C19H28O6/c1-9(20)24-11-8-18(5,23)16-15-14(11)19(16,6)13(25-10(2)21)7-12(22)17(15,3)4/h11,13-16,23H,7-8H2,1-6H3/t11-,13-,14-,15+,16-,18-,19+/m1/s1 |
| InChIKey | JFIBZHOUBKSKHL-YCOSEBASSA-N |
| XLogP | 1.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |